C20H19F2N3O2S — CID 40524641
2-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanyl]-N-[4-(difluoromethoxy)phenyl]acetamide (PubChem CID 40524641) has the molecular formula C20H19F2N3O2S and a molecular weight of 403.45 g/mol. Its IUPAC name is 2-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanyl]-N-[4-(difluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanyl]-N-[4-(difluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 40524641 |
| Molecular Formula | C20H19F2N3O2S |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 2-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanyl]-N-[4-(difluoromethoxy)phenyl]acetamide |
| SMILES | Cc1[nH]c(SCC(=O)Nc2ccc(OC(F)F)cc2)nc1Cc1ccccc1 |
| InChI | InChI=1S/C20H19F2N3O2S/c1-13-17(11-14-5-3-2-4-6-14)25-20(23-13)28-12-18(26)24-15-7-9-16(10-8-15)27-19(21)22/h2-10,19H,11-12H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | OEPWIEDJUAXCLG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |