C20H20FN3OS — CID 17404499
2-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanyl]-N-[(2-fluorophenyl)methyl]acetamide (PubChem CID 17404499) has the molecular formula C20H20FN3OS and a molecular weight of 369.47 g/mol. Its IUPAC name is 2-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanyl]-N-[(2-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanyl]-N-[(2-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 17404499 |
| Molecular Formula | C20H20FN3OS |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 2-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanyl]-N-[(2-fluorophenyl)methyl]acetamide |
| SMILES | Cc1[nH]c(SCC(=O)NCc2ccccc2F)nc1Cc1ccccc1 |
| InChI | InChI=1S/C20H20FN3OS/c1-14-18(11-15-7-3-2-4-8-15)24-20(23-14)26-13-19(25)22-12-16-9-5-6-10-17(16)21/h2-10H,11-13H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | REUQRDDQSWXPCC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |