C19H21N3OS2 — CID 28594540
2-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanyl]-N-(2-thiophen-2-ylethyl)acetamide (PubChem CID 28594540) has the molecular formula C19H21N3OS2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 2-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanyl]-N-(2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanyl]-N-(2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 28594540 |
| Molecular Formula | C19H21N3OS2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 2-[(4-benzyl-5-methyl-1H-imidazol-2-yl)sulfanyl]-N-(2-thiophen-2-ylethyl)acetamide |
| SMILES | Cc1[nH]c(SCC(=O)NCCc2cccs2)nc1Cc1ccccc1 |
| InChI | InChI=1S/C19H21N3OS2/c1-14-17(12-15-6-3-2-4-7-15)22-19(21-14)25-13-18(23)20-10-9-16-8-5-11-24-16/h2-8,11H,9-10,12-13H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | YVGSMUYIFRSWOT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |