C15H14BrNO3S — CID 40525367
2-[(R)-(4-bromophenyl)sulfinyl]-N-(4-methoxyphenyl)acetamide (PubChem CID 40525367) has the molecular formula C15H14BrNO3S and a molecular weight of 368.25 g/mol. Its IUPAC name is 2-[(R)-(4-bromophenyl)sulfinyl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[(R)-(4-bromophenyl)sulfinyl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 40525367 |
| Molecular Formula | C15H14BrNO3S |
| Molecular Weight | 368.25 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | 2-[(R)-(4-bromophenyl)sulfinyl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)C[S@@](=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C15H14BrNO3S/c1-20-13-6-4-12(5-7-13)17-15(18)10-21(19)14-8-2-11(16)3-9-14/h2-9H,10H2,1H3,(H,17,18)/t21-/m1/s1 |
| InChIKey | KMYGKZMYOCAHOQ-OAQYLSRUSA-N |
| XLogP | 3.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.25 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |