C15H14FNO3S — CID 71283163
2-[(R)-(3-fluorophenyl)sulfinyl]-N-(4-methoxyphenyl)acetamide (PubChem CID 71283163) has the molecular formula C15H14FNO3S and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-[(R)-(3-fluorophenyl)sulfinyl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[(R)-(3-fluorophenyl)sulfinyl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 71283163 |
| Molecular Formula | C15H14FNO3S |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 2-[(R)-(3-fluorophenyl)sulfinyl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)C[S@@](=O)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C15H14FNO3S/c1-20-13-7-5-12(6-8-13)17-15(18)10-21(19)14-4-2-3-11(16)9-14/h2-9H,10H2,1H3,(H,17,18)/t21-/m1/s1 |
| InChIKey | WKWHIGCHZNFZMA-OAQYLSRUSA-N |
| XLogP | 2.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |