C16H15O3- — CID 4053070
4-[(3,4-dimethylphenoxy)methyl]benzoate (PubChem CID 4053070) has the molecular formula C16H15O3- and a molecular weight of 255.29 g/mol. Its IUPAC name is 4-[(3,4-dimethylphenoxy)methyl]benzoate.
| Compound Name | 4-[(3,4-dimethylphenoxy)methyl]benzoate |
|---|---|
| PubChem CID | 4053070 |
| Molecular Formula | C16H15O3- |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 4-[(3,4-dimethylphenoxy)methyl]benzoate |
| SMILES | Cc1ccc(OCc2ccc(C(=O)[O-])cc2)cc1C |
| InChI | InChI=1S/C16H16O3/c1-11-3-8-15(9-12(11)2)19-10-13-4-6-14(7-5-13)16(17)18/h3-9H,10H2,1-2H3,(H,17,18)/p-1 |
| InChIKey | JZRVWERFZKKVPQ-UHFFFAOYSA-M |
| XLogP | 2.25 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |