C13H16N2O2 — CID 40531856
1-[(5R)-5-hydroxy-5-phenyl-4H-pyrazol-1-yl]-2-methylpropan-1-one (PubChem CID 40531856) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 1-[(5R)-5-hydroxy-5-phenyl-4H-pyrazol-1-yl]-2-methylpropan-1-one.
| Compound Name | 1-[(5R)-5-hydroxy-5-phenyl-4H-pyrazol-1-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 40531856 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 1-[(5R)-5-hydroxy-5-phenyl-4H-pyrazol-1-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1N=CC[C@@]1(O)c1ccccc1 |
| InChI | InChI=1S/C13H16N2O2/c1-10(2)12(16)15-13(17,8-9-14-15)11-6-4-3-5-7-11/h3-7,9-10,17H,8H2,1-2H3/t13-/m1/s1 |
| InChIKey | AABFFPXDKYZIPL-CYBMUJFWSA-N |
| XLogP | 1.71 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |