C18H15FN2O4 — CID 691750
methyl (5S)-1-(2-fluorobenzoyl)-5-hydroxy-5-phenyl-4H-pyrazole-3-carboxylate (PubChem CID 691750) has the molecular formula C18H15FN2O4 and a molecular weight of 342.33 g/mol. Its IUPAC name is methyl (5S)-1-(2-fluorobenzoyl)-5-hydroxy-5-phenyl-4H-pyrazole-3-carboxylate.
| Compound Name | methyl (5S)-1-(2-fluorobenzoyl)-5-hydroxy-5-phenyl-4H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 691750 |
| Molecular Formula | C18H15FN2O4 |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | methyl (5S)-1-(2-fluorobenzoyl)-5-hydroxy-5-phenyl-4H-pyrazole-3-carboxylate |
| SMILES | COC(=O)C1=NN(C(=O)c2ccccc2F)[C@@](O)(c2ccccc2)C1 |
| InChI | InChI=1S/C18H15FN2O4/c1-25-17(23)15-11-18(24,12-7-3-2-4-8-12)21(20-15)16(22)13-9-5-6-10-14(13)19/h2-10,24H,11H2,1H3/t18-/m0/s1 |
| InChIKey | UIRFQHLJNWCYMC-SFHVURJKSA-N |
| XLogP | 2.05 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |