C19H17ClN2OS — CID 40538784
(2R)-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-phenylbutanamide (PubChem CID 40538784) has the molecular formula C19H17ClN2OS and a molecular weight of 356.88 g/mol. Its IUPAC name is (2R)-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-phenylbutanamide.
| Compound Name | (2R)-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-phenylbutanamide |
|---|---|
| PubChem CID | 40538784 |
| Molecular Formula | C19H17ClN2OS |
| Molecular Weight | 356.88 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | (2R)-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-phenylbutanamide |
| SMILES | CC[C@@H](C(=O)Nc1nc(-c2ccc(Cl)cc2)cs1)c1ccccc1 |
| InChI | InChI=1S/C19H17ClN2OS/c1-2-16(13-6-4-3-5-7-13)18(23)22-19-21-17(12-24-19)14-8-10-15(20)11-9-14/h3-12,16H,2H2,1H3,(H,21,22,23)/t16-/m1/s1 |
| InChIKey | XPBCDFDNYPRIDQ-MRXNPFEDSA-N |
| XLogP | 5.60 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.88 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |