C21H21FN4O6S — CID 4054063
1-[4-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-3-nitrophenyl]-3-methylpyrrolidine-2,5-dione (PubChem CID 4054063) has the molecular formula C21H21FN4O6S and a molecular weight of 476.49 g/mol. Its IUPAC name is 1-[4-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-3-nitrophenyl]-3-methylpyrrolidine-2,5-dione.
| Compound Name | 1-[4-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-3-nitrophenyl]-3-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 4054063 |
| Molecular Formula | C21H21FN4O6S |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 1-[4-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-3-nitrophenyl]-3-methylpyrrolidine-2,5-dione |
| SMILES | CC1CC(=O)N(c2ccc(N3CCN(S(=O)(=O)c4ccc(F)cc4)CC3)c([N+](=O)[O-])c2)C1=O |
| InChI | InChI=1S/C21H21FN4O6S/c1-14-12-20(27)25(21(14)28)16-4-7-18(19(13-16)26(29)30)23-8-10-24(11-9-23)33(31,32)17-5-2-15(22)3-6-17/h2-7,13-14H,8-12H2,1H3 |
| InChIKey | IORDCAXRQVGTPN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 121.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|