C17H17N4O2P — CID 4054616
N-[anilino-[2-(furan-2-ylmethylidene)hydrazinyl]phosphoryl]aniline (PubChem CID 4054616) has the molecular formula C17H17N4O2P and a molecular weight of 340.32 g/mol. Its IUPAC name is N-[anilino-[2-(furan-2-ylmethylidene)hydrazinyl]phosphoryl]aniline.
| Compound Name | N-[anilino-[2-(furan-2-ylmethylidene)hydrazinyl]phosphoryl]aniline |
|---|---|
| PubChem CID | 4054616 |
| Molecular Formula | C17H17N4O2P |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | N-[anilino-[2-(furan-2-ylmethylidene)hydrazinyl]phosphoryl]aniline |
| SMILES | O=P(NN=Cc1ccco1)(Nc1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C17H17N4O2P/c22-24(19-15-8-3-1-4-9-15,20-16-10-5-2-6-11-16)21-18-14-17-12-7-13-23-17/h1-14H,(H3,19,20,21,22) |
| InChIKey | ZFKXONYPMYOGEL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|