About bis(anilino-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]methanethiolate);palladium(2+)
bis(anilino-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]methanethiolate);palladium(2+) (PubChem CID 52913665) has the molecular formula C24H24N6O2PdS2
and a molecular weight of 599.05 g/mol. Its IUPAC name is bis(anilino-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]methanethiolate);palladium(2+).
Molecular Properties
| Compound Name | bis(anilino-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]methanethiolate);palladium(2+) |
| PubChem CID | 52913665 |
| Molecular Formula | C24H24N6O2PdS2 |
| Molecular Weight | 599.05 g/mol |
| Exact Mass | 598.04 |
| IUPAC Name | bis(anilino-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]methanethiolate);palladium(2+) |
| SMILES | [Pd+2].[S-]C(N/N=C\c1ccco1)Nc1ccccc1.[S-]C(N/N=C\c1ccco1)Nc1ccccc1 |
| InChI | InChI=1S/2C12H13N3OS.Pd/c2*17-12(14-10-5-2-1-3-6-10)15-13-9-11-7-4-8-16-11;/h2*1-9,12,14-15,17H;/q;;+2/p-2/b2*13-9-; |
| InChIKey | WKMKYAFCUQHVIG-WUYZPBGVSA-L |
| XLogP | 4.29 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 599.05 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze bis(anilino-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]methanethiolate);palladium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(anilino-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]methanethiolate);palladium(2+)?
The IUPAC name of bis(anilino-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]methanethiolate);palladium(2+) (CID 52913665) is bis(anilino-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]methanethiolate);palladium(2+).
What is the SMILES notation for bis(anilino-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]methanethiolate);palladium(2+)?
The canonical SMILES for bis(anilino-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]methanethiolate);palladium(2+) is [Pd+2].[S-]C(N/N=C\c1ccco1)Nc1ccccc1.[S-]C(N/N=C\c1ccco1)Nc1ccccc1.
What is the InChIKey of bis(anilino-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]methanethiolate);palladium(2+)?
The InChIKey is WKMKYAFCUQHVIG-WUYZPBGVSA-L. The full InChI is InChI=1S/2C12H13N3OS.Pd/c2*17-12(14-10-5-2-1-3-6-10)15-13-9-11-7-4-8-16-11;/h2*1-9,12,14-15,17H;/q;;+2/p-2/b2*13-9-;.
What are the key properties of bis(anilino-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]methanethiolate);palladium(2+)?
bis(anilino-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]methanethiolate);palladium(2+) has a molecular weight of 599.05 g/mol, XLogP of 4.29, 10 rotatable bonds, 4 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(anilino-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]methanethiolate);palladium(2+) is sourced from PubChem (CID 52913665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).