C25H27ClF3N3O3S — CID 4054929
2-[4-chloro-3-(trifluoromethyl)phenyl]imino-N-(4-hexoxyphenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 4054929) has the molecular formula C25H27ClF3N3O3S and a molecular weight of 542.02 g/mol. Its IUPAC name is 2-[4-chloro-3-(trifluoromethyl)phenyl]imino-N-(4-hexoxyphenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | 2-[4-chloro-3-(trifluoromethyl)phenyl]imino-N-(4-hexoxyphenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 4054929 |
| Molecular Formula | C25H27ClF3N3O3S |
| Molecular Weight | 542.02 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | 2-[4-chloro-3-(trifluoromethyl)phenyl]imino-N-(4-hexoxyphenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | CCCCCCOc1ccc(NC(=O)C2CC(=O)N(C)/C(=N/c3ccc(Cl)c(C(F)(F)F)c3)S2)cc1 |
| InChI | InChI=1S/C25H27ClF3N3O3S/c1-3-4-5-6-13-35-18-10-7-16(8-11-18)30-23(34)21-15-22(33)32(2)24(36-21)31-17-9-12-20(26)19(14-17)25(27,28)29/h7-12,14,21H,3-6,13,15H2,1-2H3,(H,30,34)/b31-24- |
| InChIKey | GUAUNGQESITBID-QLTSDVKISA-N |
| XLogP | 6.91 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.02 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|