C18H15N3O2 — CID 40553243
(2R,3R)-3-(1-methylindol-3-yl)-2-nitro-3-phenylpropanenitrile (PubChem CID 40553243) has the molecular formula C18H15N3O2 and a molecular weight of 305.34 g/mol. Its IUPAC name is (2R,3R)-3-(1-methylindol-3-yl)-2-nitro-3-phenylpropanenitrile.
| Compound Name | (2R,3R)-3-(1-methylindol-3-yl)-2-nitro-3-phenylpropanenitrile |
|---|---|
| PubChem CID | 40553243 |
| Molecular Formula | C18H15N3O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | (2R,3R)-3-(1-methylindol-3-yl)-2-nitro-3-phenylpropanenitrile |
| SMILES | Cn1cc([C@@H](c2ccccc2)[C@H](C#N)[N+](=O)[O-])c2ccccc21 |
| InChI | InChI=1S/C18H15N3O2/c1-20-12-15(14-9-5-6-10-16(14)20)18(17(11-19)21(22)23)13-7-3-2-4-8-13/h2-10,12,17-18H,1H3/t17-,18+/m0/s1 |
| InChIKey | QCHBCFPZAZKHAC-ZWKOTPCHSA-N |
| XLogP | 3.48 |
| TPSA | 71.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|