C17H13Cl3F3NO — CID 40554331
3-chloro-2-[[4-[[(1R)-2,2-dichlorocyclopropyl]methoxy]phenyl]methyl]-5-(trifluoromethyl)pyridine (PubChem CID 40554331) has the molecular formula C17H13Cl3F3NO and a molecular weight of 410.65 g/mol. Its IUPAC name is 3-chloro-2-[[4-[[(1R)-2,2-dichlorocyclopropyl]methoxy]phenyl]methyl]-5-(trifluoromethyl)pyridine.
| Compound Name | 3-chloro-2-[[4-[[(1R)-2,2-dichlorocyclopropyl]methoxy]phenyl]methyl]-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 40554331 |
| Molecular Formula | C17H13Cl3F3NO |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 409.00 |
| IUPAC Name | 3-chloro-2-[[4-[[(1R)-2,2-dichlorocyclopropyl]methoxy]phenyl]methyl]-5-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1cnc(Cc2ccc(OC[C@H]3CC3(Cl)Cl)cc2)c(Cl)c1 |
| InChI | InChI=1S/C17H13Cl3F3NO/c18-14-6-11(17(21,22)23)8-24-15(14)5-10-1-3-13(4-2-10)25-9-12-7-16(12,19)20/h1-4,6,8,12H,5,7,9H2/t12-/m1/s1 |
| InChIKey | ADUBDCGORLEBBW-GFCCVEGCSA-N |
| XLogP | 5.92 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|