C15H12ClN5O — CID 4055638
2-(5-chloro-2-methyl-3-oxopyridazin-4-yl)-2-(1-methylbenzimidazol-2-yl)acetonitrile (PubChem CID 4055638) has the molecular formula C15H12ClN5O and a molecular weight of 313.75 g/mol. Its IUPAC name is 2-(5-chloro-2-methyl-3-oxopyridazin-4-yl)-2-(1-methylbenzimidazol-2-yl)acetonitrile.
| Compound Name | 2-(5-chloro-2-methyl-3-oxopyridazin-4-yl)-2-(1-methylbenzimidazol-2-yl)acetonitrile |
|---|---|
| PubChem CID | 4055638 |
| Molecular Formula | C15H12ClN5O |
| Molecular Weight | 313.75 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-(5-chloro-2-methyl-3-oxopyridazin-4-yl)-2-(1-methylbenzimidazol-2-yl)acetonitrile |
| SMILES | Cn1ncc(Cl)c(C(C#N)c2nc3ccccc3n2C)c1=O |
| InChI | InChI=1S/C15H12ClN5O/c1-20-12-6-4-3-5-11(12)19-14(20)9(7-17)13-10(16)8-18-21(2)15(13)22/h3-6,8-9H,1-2H3 |
| InChIKey | NMWXVDLQFMQGFO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 76.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.75 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |