C16H13N3O2 — CID 78869257
2-(1-methylbenzimidazol-2-yl)-3-(3-methylfuran-2-yl)-3-oxopropanenitrile (PubChem CID 78869257) has the molecular formula C16H13N3O2 and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-(1-methylbenzimidazol-2-yl)-3-(3-methylfuran-2-yl)-3-oxopropanenitrile.
| Compound Name | 2-(1-methylbenzimidazol-2-yl)-3-(3-methylfuran-2-yl)-3-oxopropanenitrile |
|---|---|
| PubChem CID | 78869257 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 2-(1-methylbenzimidazol-2-yl)-3-(3-methylfuran-2-yl)-3-oxopropanenitrile |
| SMILES | Cc1ccoc1C(=O)C(C#N)c1nc2ccccc2n1C |
| InChI | InChI=1S/C16H13N3O2/c1-10-7-8-21-15(10)14(20)11(9-17)16-18-12-5-3-4-6-13(12)19(16)2/h3-8,11H,1-2H3 |
| InChIKey | JSFXDGDDAYLTKL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 71.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |