C21H21N3O2 — CID 78869234
2-(1-methylbenzimidazol-2-yl)-6-(2-methylphenoxy)-3-oxohexanenitrile (PubChem CID 78869234) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-(1-methylbenzimidazol-2-yl)-6-(2-methylphenoxy)-3-oxohexanenitrile.
| Compound Name | 2-(1-methylbenzimidazol-2-yl)-6-(2-methylphenoxy)-3-oxohexanenitrile |
|---|---|
| PubChem CID | 78869234 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 2-(1-methylbenzimidazol-2-yl)-6-(2-methylphenoxy)-3-oxohexanenitrile |
| SMILES | Cc1ccccc1OCCCC(=O)C(C#N)c1nc2ccccc2n1C |
| InChI | InChI=1S/C21H21N3O2/c1-15-8-3-6-12-20(15)26-13-7-11-19(25)16(14-22)21-23-17-9-4-5-10-18(17)24(21)2/h3-6,8-10,12,16H,7,11,13H2,1-2H3 |
| InChIKey | VJNJSWLTQCOSLA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|