C18H25N3O2S — CID 40557044
2-[(5S)-3-ethyl-2-ethylimino-4-oxo-1,3-thiazolidin-5-yl]-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 40557044) has the molecular formula C18H25N3O2S and a molecular weight of 347.48 g/mol. Its IUPAC name is 2-[(5S)-3-ethyl-2-ethylimino-4-oxo-1,3-thiazolidin-5-yl]-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-[(5S)-3-ethyl-2-ethylimino-4-oxo-1,3-thiazolidin-5-yl]-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 40557044 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 2-[(5S)-3-ethyl-2-ethylimino-4-oxo-1,3-thiazolidin-5-yl]-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | CC/N=C1/S[C@@H](CC(=O)Nc2c(C)cc(C)cc2C)C(=O)N1CC |
| InChI | InChI=1S/C18H25N3O2S/c1-6-19-18-21(7-2)17(23)14(24-18)10-15(22)20-16-12(4)8-11(3)9-13(16)5/h8-9,14H,6-7,10H2,1-5H3,(H,20,22)/b19-18+/t14-/m0/s1 |
| InChIKey | NSWSTHHLQCSPJL-HLAUDOPJSA-N |
| XLogP | 3.28 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|