C16H21N3O2S2 — CID 1383546
2-[(5S)-3-ethyl-2-ethylimino-4-oxo-1,3-thiazolidin-5-yl]-N-(2-methylsulfanylphenyl)acetamide (PubChem CID 1383546) has the molecular formula C16H21N3O2S2 and a molecular weight of 351.50 g/mol. Its IUPAC name is 2-[(5S)-3-ethyl-2-ethylimino-4-oxo-1,3-thiazolidin-5-yl]-N-(2-methylsulfanylphenyl)acetamide.
| Compound Name | 2-[(5S)-3-ethyl-2-ethylimino-4-oxo-1,3-thiazolidin-5-yl]-N-(2-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 1383546 |
| Molecular Formula | C16H21N3O2S2 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 2-[(5S)-3-ethyl-2-ethylimino-4-oxo-1,3-thiazolidin-5-yl]-N-(2-methylsulfanylphenyl)acetamide |
| SMILES | CC/N=C1/S[C@@H](CC(=O)Nc2ccccc2SC)C(=O)N1CC |
| InChI | InChI=1S/C16H21N3O2S2/c1-4-17-16-19(5-2)15(21)13(23-16)10-14(20)18-11-8-6-7-9-12(11)22-3/h6-9,13H,4-5,10H2,1-3H3,(H,18,20)/b17-16+/t13-/m0/s1 |
| InChIKey | HMTYYZFOOJFSFS-CMTMBAJVSA-N |
| XLogP | 3.08 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|