C16H14ClN5O2S — CID 40560909
(2R)-N-(5-chloro-2-hydroxyphenyl)-2-(1-methyltetrazol-5-yl)sulfanyl-2-phenylacetamide (PubChem CID 40560909) has the molecular formula C16H14ClN5O2S and a molecular weight of 375.84 g/mol. Its IUPAC name is (2R)-N-(5-chloro-2-hydroxyphenyl)-2-(1-methyltetrazol-5-yl)sulfanyl-2-phenylacetamide.
| Compound Name | (2R)-N-(5-chloro-2-hydroxyphenyl)-2-(1-methyltetrazol-5-yl)sulfanyl-2-phenylacetamide |
|---|---|
| PubChem CID | 40560909 |
| Molecular Formula | C16H14ClN5O2S |
| Molecular Weight | 375.84 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | (2R)-N-(5-chloro-2-hydroxyphenyl)-2-(1-methyltetrazol-5-yl)sulfanyl-2-phenylacetamide |
| SMILES | Cn1nnnc1S[C@@H](C(=O)Nc1cc(Cl)ccc1O)c1ccccc1 |
| InChI | InChI=1S/C16H14ClN5O2S/c1-22-16(19-20-21-22)25-14(10-5-3-2-4-6-10)15(24)18-12-9-11(17)7-8-13(12)23/h2-9,14,23H,1H3,(H,18,24)/t14-/m1/s1 |
| InChIKey | RBPKNJVQHQGQEL-CQSZACIVSA-N |
| XLogP | 3.04 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.84 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|