C12H18N2O — CID 40570302
N-[(E)-[(1S,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-3-methylbutanamide (PubChem CID 40570302) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is N-[(E)-[(1S,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-3-methylbutanamide.
| Compound Name | N-[(E)-[(1S,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 40570302 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | N-[(E)-[(1S,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)N/N=C1\C[C@H]2C=CC[C@@H]12 |
| InChI | InChI=1S/C12H18N2O/c1-8(2)6-12(15)14-13-11-7-9-4-3-5-10(9)11/h3-4,8-10H,5-7H2,1-2H3,(H,14,15)/b13-11+/t9-,10-/m1/s1 |
| InChIKey | XJUPDZASDXCRDZ-GOKIVBARSA-N |
| XLogP | 2.10 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|