C9H11N3O2 — CID 4183850
N'-(6-bicyclo[3.2.0]hept-2-enylideneamino)oxamide (PubChem CID 4183850) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is N'-(6-bicyclo[3.2.0]hept-2-enylideneamino)oxamide.
| Compound Name | N'-(6-bicyclo[3.2.0]hept-2-enylideneamino)oxamide |
|---|---|
| PubChem CID | 4183850 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | N'-(6-bicyclo[3.2.0]hept-2-enylideneamino)oxamide |
| SMILES | NC(=O)C(=O)NN=C1CC2C=CCC12 |
| InChI | InChI=1S/C9H11N3O2/c10-8(13)9(14)12-11-7-4-5-2-1-3-6(5)7/h1-2,5-6H,3-4H2,(H2,10,13)(H,12,14) |
| InChIKey | UPPZTYBPOSKJQU-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|