C27H27N3O2 — CID 40574089
(2R)-2-phenyl-N-[(E)-1-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]ethylideneamino]butanamide (PubChem CID 40574089) has the molecular formula C27H27N3O2 and a molecular weight of 425.53 g/mol. Its IUPAC name is (2R)-2-phenyl-N-[(E)-1-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]ethylideneamino]butanamide.
| Compound Name | (2R)-2-phenyl-N-[(E)-1-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]ethylideneamino]butanamide |
|---|---|
| PubChem CID | 40574089 |
| Molecular Formula | C27H27N3O2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | (2R)-2-phenyl-N-[(E)-1-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]ethylideneamino]butanamide |
| SMILES | CC[C@@H](C(=O)N/N=C(\C)c1cccc(NC(=O)/C=C/c2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C27H27N3O2/c1-3-25(22-13-8-5-9-14-22)27(32)30-29-20(2)23-15-10-16-24(19-23)28-26(31)18-17-21-11-6-4-7-12-21/h4-19,25H,3H2,1-2H3,(H,28,31)(H,30,32)/b18-17+,29-20+/t25-/m1/s1 |
| InChIKey | HHPJAGBCUPQYMV-WTWAVSMKSA-N |
| XLogP | 5.37 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|