C13H23N4PS — CID 4058161
1-[bis(dimethylamino)phosphinothioyl]-N,N-dimethyl-N'-phenylmethanimidamide (PubChem CID 4058161) has the molecular formula C13H23N4PS and a molecular weight of 298.40 g/mol. Its IUPAC name is 1-[bis(dimethylamino)phosphinothioyl]-N,N-dimethyl-N'-phenylmethanimidamide.
| Compound Name | 1-[bis(dimethylamino)phosphinothioyl]-N,N-dimethyl-N'-phenylmethanimidamide |
|---|---|
| PubChem CID | 4058161 |
| Molecular Formula | C13H23N4PS |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 1-[bis(dimethylamino)phosphinothioyl]-N,N-dimethyl-N'-phenylmethanimidamide |
| SMILES | CN(C)/C(=N\c1ccccc1)P(=S)(N(C)C)N(C)C |
| InChI | InChI=1S/C13H23N4PS/c1-15(2)13(14-12-10-8-7-9-11-12)18(19,16(3)4)17(5)6/h7-11H,1-6H3/b14-13+ |
| InChIKey | NTSINIYDAMVBTK-BUHFOSPRSA-N |
| XLogP | 2.67 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|