C12H15N3O3 — CID 40589856
[1-[(2R)-butan-2-yl]-5-nitrobenzimidazol-2-yl]methanol (PubChem CID 40589856) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is [1-[(2R)-butan-2-yl]-5-nitrobenzimidazol-2-yl]methanol.
| Compound Name | [1-[(2R)-butan-2-yl]-5-nitrobenzimidazol-2-yl]methanol |
|---|---|
| PubChem CID | 40589856 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | [1-[(2R)-butan-2-yl]-5-nitrobenzimidazol-2-yl]methanol |
| SMILES | CC[C@@H](C)n1c(CO)nc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C12H15N3O3/c1-3-8(2)14-11-5-4-9(15(17)18)6-10(11)13-12(14)7-16/h4-6,8,16H,3,7H2,1-2H3/t8-/m1/s1 |
| InChIKey | NUBZEIYQCNHQIQ-MRVPVSSYSA-N |
| XLogP | 2.41 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|