C19H25N5O5 — CID 40610967
2-(diethylamino)ethyl 4-[(2E)-2-[1-cyano-2-(ethoxycarbonylamino)-2-oxoethylidene]hydrazinyl]benzoate (PubChem CID 40610967) has the molecular formula C19H25N5O5 and a molecular weight of 403.44 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-[(2E)-2-[1-cyano-2-(ethoxycarbonylamino)-2-oxoethylidene]hydrazinyl]benzoate.
| Compound Name | 2-(diethylamino)ethyl 4-[(2E)-2-[1-cyano-2-(ethoxycarbonylamino)-2-oxoethylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 40610967 |
| Molecular Formula | C19H25N5O5 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 2-(diethylamino)ethyl 4-[(2E)-2-[1-cyano-2-(ethoxycarbonylamino)-2-oxoethylidene]hydrazinyl]benzoate |
| SMILES | CCOC(=O)NC(=O)/C(C#N)=N/Nc1ccc(C(=O)OCCN(CC)CC)cc1 |
| InChI | InChI=1S/C19H25N5O5/c1-4-24(5-2)11-12-29-18(26)14-7-9-15(10-8-14)22-23-16(13-20)17(25)21-19(27)28-6-3/h7-10,22H,4-6,11-12H2,1-3H3,(H,21,25,27)/b23-16+ |
| InChIKey | UPPILSNNQRZUMV-XQNSMLJCSA-N |
| XLogP | 1.75 |
| TPSA | 133.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|