C17H23F2N3O — CID 40621858
N-[(1S)-1-(1-adamantyl)ethyl]-1-(difluoromethyl)pyrazole-3-carboxamide (PubChem CID 40621858) has the molecular formula C17H23F2N3O and a molecular weight of 323.39 g/mol. Its IUPAC name is N-[(1S)-1-(1-adamantyl)ethyl]-1-(difluoromethyl)pyrazole-3-carboxamide.
| Compound Name | N-[(1S)-1-(1-adamantyl)ethyl]-1-(difluoromethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 40621858 |
| Molecular Formula | C17H23F2N3O |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | N-[(1S)-1-(1-adamantyl)ethyl]-1-(difluoromethyl)pyrazole-3-carboxamide |
| SMILES | C[C@H](NC(=O)c1ccn(C(F)F)n1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H23F2N3O/c1-10(20-15(23)14-2-3-22(21-14)16(18)19)17-7-11-4-12(8-17)6-13(5-11)9-17/h2-3,10-13,16H,4-9H2,1H3,(H,20,23)/t10-,11?,12?,13?,17?/m0/s1 |
| InChIKey | OHIMSGLUVQCLNM-DKHPWKACSA-N |
| XLogP | 3.61 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |