C25H36N2O2S — CID 40625227
1-[2-(3,4-diethoxyphenyl)ethyl]-3-[(1R)-1-(4-propan-2-ylphenyl)propyl]thiourea (PubChem CID 40625227) has the molecular formula C25H36N2O2S and a molecular weight of 428.64 g/mol. Its IUPAC name is 1-[2-(3,4-diethoxyphenyl)ethyl]-3-[(1R)-1-(4-propan-2-ylphenyl)propyl]thiourea.
| Compound Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-[(1R)-1-(4-propan-2-ylphenyl)propyl]thiourea |
|---|---|
| PubChem CID | 40625227 |
| Molecular Formula | C25H36N2O2S |
| Molecular Weight | 428.64 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-[(1R)-1-(4-propan-2-ylphenyl)propyl]thiourea |
| SMILES | CCOc1ccc(CCNC(=S)N[C@H](CC)c2ccc(C(C)C)cc2)cc1OCC |
| InChI | InChI=1S/C25H36N2O2S/c1-6-22(21-12-10-20(11-13-21)18(4)5)27-25(30)26-16-15-19-9-14-23(28-7-2)24(17-19)29-8-3/h9-14,17-18,22H,6-8,15-16H2,1-5H3,(H2,26,27,30)/t22-/m1/s1 |
| InChIKey | BQOWKUBQCLNEBP-JOCHJYFZSA-N |
| XLogP | 5.77 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.64 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|