C18H21ClN2S — CID 5000601
1-[2-(4-chlorophenyl)ethyl]-3-(1-phenylpropyl)thiourea (PubChem CID 5000601) has the molecular formula C18H21ClN2S and a molecular weight of 332.90 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)ethyl]-3-(1-phenylpropyl)thiourea.
| Compound Name | 1-[2-(4-chlorophenyl)ethyl]-3-(1-phenylpropyl)thiourea |
|---|---|
| PubChem CID | 5000601 |
| Molecular Formula | C18H21ClN2S |
| Molecular Weight | 332.90 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 1-[2-(4-chlorophenyl)ethyl]-3-(1-phenylpropyl)thiourea |
| SMILES | CCC(NC(=S)NCCc1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H21ClN2S/c1-2-17(15-6-4-3-5-7-15)21-18(22)20-13-12-14-8-10-16(19)11-9-14/h3-11,17H,2,12-13H2,1H3,(H2,20,21,22) |
| InChIKey | SAYQHZQBLGKDOJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.90 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|