C6H11NO3 — CID 40630429
2-[(2S,4R)-4-hydroxypyrrolidin-1-ium-2-yl]acetate (PubChem CID 40630429) has the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. Its IUPAC name is 2-[(2S,4R)-4-hydroxypyrrolidin-1-ium-2-yl]acetate.
| Compound Name | 2-[(2S,4R)-4-hydroxypyrrolidin-1-ium-2-yl]acetate |
|---|---|
| PubChem CID | 40630429 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 2-[(2S,4R)-4-hydroxypyrrolidin-1-ium-2-yl]acetate |
| SMILES | O=C([O-])C[C@@H]1C[C@@H](O)C[NH2+]1 |
| InChI | InChI=1S/C6H11NO3/c8-5-1-4(7-3-5)2-6(9)10/h4-5,7-8H,1-3H2,(H,9,10)/t4-,5+/m0/s1 |
| InChIKey | HEUWVFJLYQNYMK-CRCLSJGQSA-N |
| XLogP | -3.18 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |