C22H28ClN3O2S — CID 40631999
1-[(Z)-[2-[2-[4-[(2R)-butan-2-yl]phenoxy]ethoxy]-5-chlorophenyl]methylideneamino]-3-ethylthiourea (PubChem CID 40631999) has the molecular formula C22H28ClN3O2S and a molecular weight of 434.01 g/mol. Its IUPAC name is 1-[(Z)-[2-[2-[4-[(2R)-butan-2-yl]phenoxy]ethoxy]-5-chlorophenyl]methylideneamino]-3-ethylthiourea.
| Compound Name | 1-[(Z)-[2-[2-[4-[(2R)-butan-2-yl]phenoxy]ethoxy]-5-chlorophenyl]methylideneamino]-3-ethylthiourea |
|---|---|
| PubChem CID | 40631999 |
| Molecular Formula | C22H28ClN3O2S |
| Molecular Weight | 434.01 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 1-[(Z)-[2-[2-[4-[(2R)-butan-2-yl]phenoxy]ethoxy]-5-chlorophenyl]methylideneamino]-3-ethylthiourea |
| SMILES | CCNC(=S)N/N=C\c1cc(Cl)ccc1OCCOc1ccc([C@H](C)CC)cc1 |
| InChI | InChI=1S/C22H28ClN3O2S/c1-4-16(3)17-6-9-20(10-7-17)27-12-13-28-21-11-8-19(23)14-18(21)15-25-26-22(29)24-5-2/h6-11,14-16H,4-5,12-13H2,1-3H3,(H2,24,26,29)/b25-15-/t16-/m1/s1 |
| InChIKey | UYPHKGGUTMMQFG-MKCIMWKDSA-N |
| XLogP | 5.13 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.01 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|