C22H27NOS — CID 40634751
(2R)-N-cyclohexyl-N-ethyl-2-phenyl-2-phenylsulfanylacetamide (PubChem CID 40634751) has the molecular formula C22H27NOS and a molecular weight of 353.53 g/mol. Its IUPAC name is (2R)-N-cyclohexyl-N-ethyl-2-phenyl-2-phenylsulfanylacetamide.
| Compound Name | (2R)-N-cyclohexyl-N-ethyl-2-phenyl-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 40634751 |
| Molecular Formula | C22H27NOS |
| Molecular Weight | 353.53 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | (2R)-N-cyclohexyl-N-ethyl-2-phenyl-2-phenylsulfanylacetamide |
| SMILES | CCN(C(=O)[C@H](Sc1ccccc1)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C22H27NOS/c1-2-23(19-14-8-4-9-15-19)22(24)21(18-12-6-3-7-13-18)25-20-16-10-5-11-17-20/h3,5-7,10-13,16-17,19,21H,2,4,8-9,14-15H2,1H3/t21-/m1/s1 |
| InChIKey | VFMVXEYYRIQXSI-OAQYLSRUSA-N |
| XLogP | 5.70 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.53 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |