C17H16N2O2S2 — CID 40636953
(5S)-5-(4-ethoxyanilino)-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 40636953) has the molecular formula C17H16N2O2S2 and a molecular weight of 344.46 g/mol. Its IUPAC name is (5S)-5-(4-ethoxyanilino)-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5S)-5-(4-ethoxyanilino)-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 40636953 |
| Molecular Formula | C17H16N2O2S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | (5S)-5-(4-ethoxyanilino)-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCOc1ccc(N[C@H]2SC(=S)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C17H16N2O2S2/c1-2-21-14-10-8-12(9-11-14)18-15-16(20)19(17(22)23-15)13-6-4-3-5-7-13/h3-11,15,18H,2H2,1H3/t15-/m0/s1 |
| InChIKey | OCJUOZBMBQOIPJ-HNNXBMFYSA-N |
| XLogP | 3.89 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|