C18H21Cl2NO4 — CID 40645274
2-propoxyethyl (4S)-4-(2,3-dichlorophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyridine-5-carboxylate (PubChem CID 40645274) has the molecular formula C18H21Cl2NO4 and a molecular weight of 386.28 g/mol. Its IUPAC name is 2-propoxyethyl (4S)-4-(2,3-dichlorophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyridine-5-carboxylate.
| Compound Name | 2-propoxyethyl (4S)-4-(2,3-dichlorophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 40645274 |
| Molecular Formula | C18H21Cl2NO4 |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 2-propoxyethyl (4S)-4-(2,3-dichlorophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyridine-5-carboxylate |
| SMILES | CCCOCCOC(=O)C1=C(C)NC(=O)C[C@@H]1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C18H21Cl2NO4/c1-3-7-24-8-9-25-18(23)16-11(2)21-15(22)10-13(16)12-5-4-6-14(19)17(12)20/h4-6,13H,3,7-10H2,1-2H3,(H,21,22)/t13-/m1/s1 |
| InChIKey | FVBYISJSNAPVEJ-CYBMUJFWSA-N |
| XLogP | 3.84 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|