C16H17ClFNO4 — CID 7127195
2-methoxyethyl (4R)-4-(2-chloro-6-fluorophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyridine-5-carboxylate (PubChem CID 7127195) has the molecular formula C16H17ClFNO4 and a molecular weight of 341.77 g/mol. Its IUPAC name is 2-methoxyethyl (4R)-4-(2-chloro-6-fluorophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyridine-5-carboxylate.
| Compound Name | 2-methoxyethyl (4R)-4-(2-chloro-6-fluorophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 7127195 |
| Molecular Formula | C16H17ClFNO4 |
| Molecular Weight | 341.77 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 2-methoxyethyl (4R)-4-(2-chloro-6-fluorophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyridine-5-carboxylate |
| SMILES | COCCOC(=O)C1=C(C)NC(=O)C[C@H]1c1c(F)cccc1Cl |
| InChI | InChI=1S/C16H17ClFNO4/c1-9-14(16(21)23-7-6-22-2)10(8-13(20)19-9)15-11(17)4-3-5-12(15)18/h3-5,10H,6-8H2,1-2H3,(H,19,20)/t10-/m1/s1 |
| InChIKey | YBPXPSICTROIJY-SNVBAGLBSA-N |
| XLogP | 2.55 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.77 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|