About 4-[[[(2R)-butan-2-yl]amino]methyl]-N,N-diethylaniline
4-[[[(2R)-butan-2-yl]amino]methyl]-N,N-diethylaniline (PubChem CID 40649734) has the molecular formula C15H26N2
and a molecular weight of 234.39 g/mol. Its IUPAC name is 4-[[[(2R)-butan-2-yl]amino]methyl]-N,N-diethylaniline.
Molecular Properties
| Compound Name | 4-[[[(2R)-butan-2-yl]amino]methyl]-N,N-diethylaniline |
| PubChem CID | 40649734 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 4-[[[(2R)-butan-2-yl]amino]methyl]-N,N-diethylaniline |
| SMILES | CC[C@@H](C)NCc1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C15H26N2/c1-5-13(4)16-12-14-8-10-15(11-9-14)17(6-2)7-3/h8-11,13,16H,5-7,12H2,1-4H3/t13-/m1/s1 |
| InChIKey | CULMSAFPCZWOAC-CYBMUJFWSA-N |
| XLogP | 3.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 4-[[[(2R)-butan-2-yl]amino]methyl]-N,N-diethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[[(2R)-butan-2-yl]amino]methyl]-N,N-diethylaniline?
The IUPAC name of 4-[[[(2R)-butan-2-yl]amino]methyl]-N,N-diethylaniline (CID 40649734) is 4-[[[(2R)-butan-2-yl]amino]methyl]-N,N-diethylaniline.
What is the SMILES notation for 4-[[[(2R)-butan-2-yl]amino]methyl]-N,N-diethylaniline?
The canonical SMILES for 4-[[[(2R)-butan-2-yl]amino]methyl]-N,N-diethylaniline is CC[C@@H](C)NCc1ccc(N(CC)CC)cc1.
What is the InChIKey of 4-[[[(2R)-butan-2-yl]amino]methyl]-N,N-diethylaniline?
The InChIKey is CULMSAFPCZWOAC-CYBMUJFWSA-N. The full InChI is InChI=1S/C15H26N2/c1-5-13(4)16-12-14-8-10-15(11-9-14)17(6-2)7-3/h8-11,13,16H,5-7,12H2,1-4H3/t13-/m1/s1.
What are the key properties of 4-[[[(2R)-butan-2-yl]amino]methyl]-N,N-diethylaniline?
4-[[[(2R)-butan-2-yl]amino]methyl]-N,N-diethylaniline has a molecular weight of 234.39 g/mol, XLogP of 3.42, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[[(2R)-butan-2-yl]amino]methyl]-N,N-diethylaniline is sourced from PubChem (CID 40649734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).