C20H40N2 — CID 166461654
N-[[4-[3-[ethyl(methyl)amino]propyl]phenyl]methyl]butan-2-amine;molecular hydrogen;propane (PubChem CID 166461654) has the molecular formula C20H40N2 and a molecular weight of 308.55 g/mol. Its IUPAC name is N-[[4-[3-[ethyl(methyl)amino]propyl]phenyl]methyl]butan-2-amine;molecular hydrogen;propane.
| Compound Name | N-[[4-[3-[ethyl(methyl)amino]propyl]phenyl]methyl]butan-2-amine;molecular hydrogen;propane |
|---|---|
| PubChem CID | 166461654 |
| Molecular Formula | C20H40N2 |
| Molecular Weight | 308.55 g/mol |
| Exact Mass | 308.32 |
| IUPAC Name | N-[[4-[3-[ethyl(methyl)amino]propyl]phenyl]methyl]butan-2-amine;molecular hydrogen;propane |
| SMILES | CCC.CCC(C)NCc1ccc(CCCN(C)CC)cc1.[H][H] |
| InChI | InChI=1S/C17H30N2.C3H8.H2/c1-5-15(3)18-14-17-11-9-16(10-12-17)8-7-13-19(4)6-2;1-3-2;/h9-12,15,18H,5-8,13-14H2,1-4H3;3H2,1-2H3;1H |
| InChIKey | CCEZKJBOVSGLQR-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |