C14H24N2 — CID 115715577
4-[2-(butan-2-ylamino)ethyl]-N,N-dimethylaniline (PubChem CID 115715577) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 4-[2-(butan-2-ylamino)ethyl]-N,N-dimethylaniline.
| Compound Name | 4-[2-(butan-2-ylamino)ethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 115715577 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 4-[2-(butan-2-ylamino)ethyl]-N,N-dimethylaniline |
| SMILES | CCC(C)NCCc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C14H24N2/c1-5-12(2)15-11-10-13-6-8-14(9-7-13)16(3)4/h6-9,12,15H,5,10-11H2,1-4H3 |
| InChIKey | KOYXDCMARIOWFW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|