C22H23N5O5S — CID 40652032
4-amino-5-N-[(1S)-1-(4-hydroxyphenyl)-2-(2-methoxyethylamino)-2-oxoethyl]-5-N-phenyl-1,2-thiazole-3,5-dicarboxamide (PubChem CID 40652032) has the molecular formula C22H23N5O5S and a molecular weight of 469.52 g/mol. Its IUPAC name is 4-amino-5-N-[(1S)-1-(4-hydroxyphenyl)-2-(2-methoxyethylamino)-2-oxoethyl]-5-N-phenyl-1,2-thiazole-3,5-dicarboxamide.
| Compound Name | 4-amino-5-N-[(1S)-1-(4-hydroxyphenyl)-2-(2-methoxyethylamino)-2-oxoethyl]-5-N-phenyl-1,2-thiazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 40652032 |
| Molecular Formula | C22H23N5O5S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 4-amino-5-N-[(1S)-1-(4-hydroxyphenyl)-2-(2-methoxyethylamino)-2-oxoethyl]-5-N-phenyl-1,2-thiazole-3,5-dicarboxamide |
| SMILES | COCCNC(=O)[C@H](c1ccc(O)cc1)N(C(=O)c1snc(C(N)=O)c1N)c1ccccc1 |
| InChI | InChI=1S/C22H23N5O5S/c1-32-12-11-25-21(30)18(13-7-9-15(28)10-8-13)27(14-5-3-2-4-6-14)22(31)19-16(23)17(20(24)29)26-33-19/h2-10,18,28H,11-12,23H2,1H3,(H2,24,29)(H,25,30)/t18-/m0/s1 |
| InChIKey | BABWTMFIEKUXMY-SFHVURJKSA-N |
| XLogP | 1.68 |
| TPSA | 160.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|