C25H24N6O4S — CID 40587267
4-amino-5-N-[(1S)-2-(2-methoxyethylamino)-2-oxo-1-quinolin-6-ylethyl]-5-N-phenyl-1,2-thiazole-3,5-dicarboxamide (PubChem CID 40587267) has the molecular formula C25H24N6O4S and a molecular weight of 504.57 g/mol. Its IUPAC name is 4-amino-5-N-[(1S)-2-(2-methoxyethylamino)-2-oxo-1-quinolin-6-ylethyl]-5-N-phenyl-1,2-thiazole-3,5-dicarboxamide.
| Compound Name | 4-amino-5-N-[(1S)-2-(2-methoxyethylamino)-2-oxo-1-quinolin-6-ylethyl]-5-N-phenyl-1,2-thiazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 40587267 |
| Molecular Formula | C25H24N6O4S |
| Molecular Weight | 504.57 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 4-amino-5-N-[(1S)-2-(2-methoxyethylamino)-2-oxo-1-quinolin-6-ylethyl]-5-N-phenyl-1,2-thiazole-3,5-dicarboxamide |
| SMILES | COCCNC(=O)[C@H](c1ccc2ncccc2c1)N(C(=O)c1snc(C(N)=O)c1N)c1ccccc1 |
| InChI | InChI=1S/C25H24N6O4S/c1-35-13-12-29-24(33)21(16-9-10-18-15(14-16)6-5-11-28-18)31(17-7-3-2-4-8-17)25(34)22-19(26)20(23(27)32)30-36-22/h2-11,14,21H,12-13,26H2,1H3,(H2,27,32)(H,29,33)/t21-/m0/s1 |
| InChIKey | RXLAGWDNGDGTKN-NRFANRHFSA-N |
| XLogP | 2.52 |
| TPSA | 153.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.57 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|