C27H28N6O4S — CID 3189161
4-amino-5-N-[2-(2-methoxyethylamino)-2-oxo-1-quinolin-6-ylethyl]-5-N-(2-phenylethyl)-1,2-thiazole-3,5-dicarboxamide (PubChem CID 3189161) has the molecular formula C27H28N6O4S and a molecular weight of 532.63 g/mol. Its IUPAC name is 4-amino-5-N-[2-(2-methoxyethylamino)-2-oxo-1-quinolin-6-ylethyl]-5-N-(2-phenylethyl)-1,2-thiazole-3,5-dicarboxamide.
| Compound Name | 4-amino-5-N-[2-(2-methoxyethylamino)-2-oxo-1-quinolin-6-ylethyl]-5-N-(2-phenylethyl)-1,2-thiazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 3189161 |
| Molecular Formula | C27H28N6O4S |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | 4-amino-5-N-[2-(2-methoxyethylamino)-2-oxo-1-quinolin-6-ylethyl]-5-N-(2-phenylethyl)-1,2-thiazole-3,5-dicarboxamide |
| SMILES | COCCNC(=O)C(c1ccc2ncccc2c1)N(CCc1ccccc1)C(=O)c1snc(C(N)=O)c1N |
| InChI | InChI=1S/C27H28N6O4S/c1-37-15-13-31-26(35)23(19-9-10-20-18(16-19)8-5-12-30-20)33(14-11-17-6-3-2-4-7-17)27(36)24-21(28)22(25(29)34)32-38-24/h2-10,12,16,23H,11,13-15,28H2,1H3,(H2,29,34)(H,31,35) |
| InChIKey | PMEGYSVGLYADHA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 153.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|