C22H26N4O3S — CID 4065775
3-(2-ethoxyethyl)-5-methyl-6-(4-phenylpiperazine-1-carbonyl)thieno[2,3-d]pyrimidin-4-one (PubChem CID 4065775) has the molecular formula C22H26N4O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is 3-(2-ethoxyethyl)-5-methyl-6-(4-phenylpiperazine-1-carbonyl)thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-(2-ethoxyethyl)-5-methyl-6-(4-phenylpiperazine-1-carbonyl)thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 4065775 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 3-(2-ethoxyethyl)-5-methyl-6-(4-phenylpiperazine-1-carbonyl)thieno[2,3-d]pyrimidin-4-one |
| SMILES | CCOCCn1cnc2sc(C(=O)N3CCN(c4ccccc4)CC3)c(C)c2c1=O |
| InChI | InChI=1S/C22H26N4O3S/c1-3-29-14-13-26-15-23-20-18(21(26)27)16(2)19(30-20)22(28)25-11-9-24(10-12-25)17-7-5-4-6-8-17/h4-8,15H,3,9-14H2,1-2H3 |
| InChIKey | XUPSZCJWVBAWKF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|