C18H25N3O3S — CID 4065777
3-(2-ethoxyethyl)-5-methyl-6-(3-methylpiperidine-1-carbonyl)thieno[2,3-d]pyrimidin-4-one (PubChem CID 4065777) has the molecular formula C18H25N3O3S and a molecular weight of 363.48 g/mol. Its IUPAC name is 3-(2-ethoxyethyl)-5-methyl-6-(3-methylpiperidine-1-carbonyl)thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-(2-ethoxyethyl)-5-methyl-6-(3-methylpiperidine-1-carbonyl)thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 4065777 |
| Molecular Formula | C18H25N3O3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 3-(2-ethoxyethyl)-5-methyl-6-(3-methylpiperidine-1-carbonyl)thieno[2,3-d]pyrimidin-4-one |
| SMILES | CCOCCn1cnc2sc(C(=O)N3CCCC(C)C3)c(C)c2c1=O |
| InChI | InChI=1S/C18H25N3O3S/c1-4-24-9-8-21-11-19-16-14(17(21)22)13(3)15(25-16)18(23)20-7-5-6-12(2)10-20/h11-12H,4-10H2,1-3H3 |
| InChIKey | NCMIUVDGVQAGEZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|