C26H24N2OS — CID 40684745
N-[3-[(R)-anilino(phenyl)methyl]-4,5-dimethylthiophen-2-yl]benzamide (PubChem CID 40684745) has the molecular formula C26H24N2OS and a molecular weight of 412.56 g/mol. Its IUPAC name is N-[3-[(R)-anilino(phenyl)methyl]-4,5-dimethylthiophen-2-yl]benzamide.
| Compound Name | N-[3-[(R)-anilino(phenyl)methyl]-4,5-dimethylthiophen-2-yl]benzamide |
|---|---|
| PubChem CID | 40684745 |
| Molecular Formula | C26H24N2OS |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N-[3-[(R)-anilino(phenyl)methyl]-4,5-dimethylthiophen-2-yl]benzamide |
| SMILES | Cc1sc(NC(=O)c2ccccc2)c([C@H](Nc2ccccc2)c2ccccc2)c1C |
| InChI | InChI=1S/C26H24N2OS/c1-18-19(2)30-26(28-25(29)21-14-8-4-9-15-21)23(18)24(20-12-6-3-7-13-20)27-22-16-10-5-11-17-22/h3-17,24,27H,1-2H3,(H,28,29)/t24-/m1/s1 |
| InChIKey | RZGPJRMZIFWLMM-XMMPIXPASA-N |
| XLogP | 6.82 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |