C26H23ClN2OS — CID 4702234
N-[3-[anilino-(4-chlorophenyl)methyl]-4,5-dimethylthiophen-2-yl]benzamide (PubChem CID 4702234) has the molecular formula C26H23ClN2OS and a molecular weight of 447.00 g/mol. Its IUPAC name is N-[3-[anilino-(4-chlorophenyl)methyl]-4,5-dimethylthiophen-2-yl]benzamide.
| Compound Name | N-[3-[anilino-(4-chlorophenyl)methyl]-4,5-dimethylthiophen-2-yl]benzamide |
|---|---|
| PubChem CID | 4702234 |
| Molecular Formula | C26H23ClN2OS |
| Molecular Weight | 447.00 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | N-[3-[anilino-(4-chlorophenyl)methyl]-4,5-dimethylthiophen-2-yl]benzamide |
| SMILES | Cc1sc(NC(=O)c2ccccc2)c(C(Nc2ccccc2)c2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C26H23ClN2OS/c1-17-18(2)31-26(29-25(30)20-9-5-3-6-10-20)23(17)24(19-13-15-21(27)16-14-19)28-22-11-7-4-8-12-22/h3-16,24,28H,1-2H3,(H,29,30) |
| InChIKey | PZEYHPDPENKTTN-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.00 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |