C17H17N3O3 — CID 40693833
3-[2-(5-ethyl-1,3,4-oxadiazol-2-yl)indol-1-yl]pentane-2,4-dione (PubChem CID 40693833) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is 3-[2-(5-ethyl-1,3,4-oxadiazol-2-yl)indol-1-yl]pentane-2,4-dione.
| Compound Name | 3-[2-(5-ethyl-1,3,4-oxadiazol-2-yl)indol-1-yl]pentane-2,4-dione |
|---|---|
| PubChem CID | 40693833 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 3-[2-(5-ethyl-1,3,4-oxadiazol-2-yl)indol-1-yl]pentane-2,4-dione |
| SMILES | CCc1nnc(-c2cc3ccccc3n2C(C(C)=O)C(C)=O)o1 |
| InChI | InChI=1S/C17H17N3O3/c1-4-15-18-19-17(23-15)14-9-12-7-5-6-8-13(12)20(14)16(10(2)21)11(3)22/h5-9,16H,4H2,1-3H3 |
| InChIKey | IBFOULSQWBMPHP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 77.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|