C21H19N3O3 — CID 40693804
benzyl 2-[2-(5-ethyl-1,3,4-oxadiazol-2-yl)indol-1-yl]acetate (PubChem CID 40693804) has the molecular formula C21H19N3O3 and a molecular weight of 361.40 g/mol. Its IUPAC name is benzyl 2-[2-(5-ethyl-1,3,4-oxadiazol-2-yl)indol-1-yl]acetate.
| Compound Name | benzyl 2-[2-(5-ethyl-1,3,4-oxadiazol-2-yl)indol-1-yl]acetate |
|---|---|
| PubChem CID | 40693804 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | benzyl 2-[2-(5-ethyl-1,3,4-oxadiazol-2-yl)indol-1-yl]acetate |
| SMILES | CCc1nnc(-c2cc3ccccc3n2CC(=O)OCc2ccccc2)o1 |
| InChI | InChI=1S/C21H19N3O3/c1-2-19-22-23-21(27-19)18-12-16-10-6-7-11-17(16)24(18)13-20(25)26-14-15-8-4-3-5-9-15/h3-12H,2,13-14H2,1H3 |
| InChIKey | HBXOUQKZVRMVPX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |