C14H13N3O3 — CID 40694221
ethyl 2-[2-(1,3,4-oxadiazol-2-yl)indol-1-yl]acetate (PubChem CID 40694221) has the molecular formula C14H13N3O3 and a molecular weight of 271.28 g/mol. Its IUPAC name is ethyl 2-[2-(1,3,4-oxadiazol-2-yl)indol-1-yl]acetate.
| Compound Name | ethyl 2-[2-(1,3,4-oxadiazol-2-yl)indol-1-yl]acetate |
|---|---|
| PubChem CID | 40694221 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | ethyl 2-[2-(1,3,4-oxadiazol-2-yl)indol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(-c2nnco2)cc2ccccc21 |
| InChI | InChI=1S/C14H13N3O3/c1-2-19-13(18)8-17-11-6-4-3-5-10(11)7-12(17)14-16-15-9-20-14/h3-7,9H,2,8H2,1H3 |
| InChIKey | MZAZUNJUBNIZLJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |