C16H17N3O3 — CID 40694284
2-[1-[2-(1,3-dioxan-2-yl)ethyl]indol-2-yl]-1,3,4-oxadiazole (PubChem CID 40694284) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-[1-[2-(1,3-dioxan-2-yl)ethyl]indol-2-yl]-1,3,4-oxadiazole.
| Compound Name | 2-[1-[2-(1,3-dioxan-2-yl)ethyl]indol-2-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 40694284 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-[1-[2-(1,3-dioxan-2-yl)ethyl]indol-2-yl]-1,3,4-oxadiazole |
| SMILES | c1ccc2c(c1)cc(-c1nnco1)n2CCC1OCCCO1 |
| InChI | InChI=1S/C16H17N3O3/c1-2-5-13-12(4-1)10-14(16-18-17-11-22-16)19(13)7-6-15-20-8-3-9-21-15/h1-2,4-5,10-11,15H,3,6-9H2 |
| InChIKey | IPDKNLQPFGSOLO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 62.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |